C11H18N2OS — CID 94782519
(2S)-2-(4-tert-butyl-1,3-thiazol-2-yl)morpholine (PubChem CID 94782519) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is (2S)-2-(4-tert-butyl-1,3-thiazol-2-yl)morpholine.
| Compound Name | (2S)-2-(4-tert-butyl-1,3-thiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 94782519 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (2S)-2-(4-tert-butyl-1,3-thiazol-2-yl)morpholine |
| SMILES | CC(C)(C)c1csc([C@@H]2CNCCO2)n1 |
| InChI | InChI=1S/C11H18N2OS/c1-11(2,3)9-7-15-10(13-9)8-6-12-4-5-14-8/h7-8,12H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | DZECWAJGOYTBDU-QMMMGPOBSA-N |
| XLogP | 2.10 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |