C11H10Cl2N2OS2 — CID 114082858
2-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]morpholine (PubChem CID 114082858) has the molecular formula C11H10Cl2N2OS2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | 2-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 114082858 |
| Molecular Formula | C11H10Cl2N2OS2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 2-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]morpholine |
| SMILES | Clc1cc(-c2csc(C3CNCCO3)n2)c(Cl)s1 |
| InChI | InChI=1S/C11H10Cl2N2OS2/c12-9-3-6(10(13)18-9)7-5-17-11(15-7)8-4-14-1-2-16-8/h3,5,8,14H,1-2,4H2 |
| InChIKey | UGBQPJIVETXRCC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |