C14H15FN2O2S — CID 177184063
(2R)-2-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 177184063) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is (2R)-2-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | (2R)-2-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 177184063 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2R)-2-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | COc1ccc(F)cc1-c1csc([C@H]2CNCCO2)n1 |
| InChI | InChI=1S/C14H15FN2O2S/c1-18-12-3-2-9(15)6-10(12)11-8-20-14(17-11)13-7-16-4-5-19-13/h2-3,6,8,13,16H,4-5,7H2,1H3/t13-/m1/s1 |
| InChIKey | PRLTZNJWMAMJSI-CYBMUJFWSA-N |
| XLogP | 2.62 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |