C16H22N2O2S — CID 177183918
ethane;2-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 177183918) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is ethane;2-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | ethane;2-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 177183918 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | ethane;2-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | CC.COc1ccccc1-c1csc(C2CNCCO2)n1 |
| InChI | InChI=1S/C14H16N2O2S.C2H6/c1-17-12-5-3-2-4-10(12)11-9-19-14(16-11)13-8-15-6-7-18-13;1-2/h2-5,9,13,15H,6-8H2,1H3;1-2H3 |
| InChIKey | UJNGJWORJWUKCS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |