C12H15N3O2 — CID 105492700
2-(8-methoxyimidazo[1,2-a]pyridin-2-yl)morpholine (PubChem CID 105492700) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(8-methoxyimidazo[1,2-a]pyridin-2-yl)morpholine.
| Compound Name | 2-(8-methoxyimidazo[1,2-a]pyridin-2-yl)morpholine |
|---|---|
| PubChem CID | 105492700 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-(8-methoxyimidazo[1,2-a]pyridin-2-yl)morpholine |
| SMILES | COc1cccn2cc(C3CNCCO3)nc12 |
| InChI | InChI=1S/C12H15N3O2/c1-16-10-3-2-5-15-8-9(14-12(10)15)11-7-13-4-6-17-11/h2-3,5,8,11,13H,4,6-7H2,1H3 |
| InChIKey | HMFFEUQAACEMLF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |