About 2-pyridin-2-ylmorpholine
2-pyridin-2-ylmorpholine (PubChem CID 19353403) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-pyridin-2-ylmorpholine.
Molecular Properties
| Compound Name | 2-pyridin-2-ylmorpholine |
| PubChem CID | 19353403 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-pyridin-2-ylmorpholine |
| SMILES | c1ccc(C2CNCCO2)nc1 |
| InChI | InChI=1S/C9H12N2O/c1-2-4-11-8(3-1)9-7-10-5-6-12-9/h1-4,9-10H,5-7H2 |
| InChIKey | FJJYSUQONMBDJJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylmorpholine?
The IUPAC name of 2-pyridin-2-ylmorpholine (CID 19353403) is 2-pyridin-2-ylmorpholine.
What is the SMILES notation for 2-pyridin-2-ylmorpholine?
The canonical SMILES for 2-pyridin-2-ylmorpholine is c1ccc(C2CNCCO2)nc1.
What is the InChIKey of 2-pyridin-2-ylmorpholine?
The InChIKey is FJJYSUQONMBDJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-4-11-8(3-1)9-7-10-5-6-12-9/h1-4,9-10H,5-7H2.
What are the key properties of 2-pyridin-2-ylmorpholine?
2-pyridin-2-ylmorpholine has a molecular weight of 164.21 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylmorpholine is sourced from PubChem (CID 19353403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).