About 2-(1,4-dioxan-2-yl)pyridine;hydrochloride
2-(1,4-dioxan-2-yl)pyridine;hydrochloride (PubChem CID 174921928) has the molecular formula C9H12ClNO2
and a molecular weight of 201.65 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yl)pyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1,4-dioxan-2-yl)pyridine;hydrochloride |
| PubChem CID | 174921928 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-(1,4-dioxan-2-yl)pyridine;hydrochloride |
| SMILES | Cl.c1ccc(C2COCCO2)nc1 |
| InChI | InChI=1S/C9H11NO2.ClH/c1-2-4-10-8(3-1)9-7-11-5-6-12-9;/h1-4,9H,5-7H2;1H |
| InChIKey | QSWFEURRYYQBKN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-dioxan-2-yl)pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxan-2-yl)pyridine;hydrochloride?
The IUPAC name of 2-(1,4-dioxan-2-yl)pyridine;hydrochloride (CID 174921928) is 2-(1,4-dioxan-2-yl)pyridine;hydrochloride.
What is the SMILES notation for 2-(1,4-dioxan-2-yl)pyridine;hydrochloride?
The canonical SMILES for 2-(1,4-dioxan-2-yl)pyridine;hydrochloride is Cl.c1ccc(C2COCCO2)nc1.
What is the InChIKey of 2-(1,4-dioxan-2-yl)pyridine;hydrochloride?
The InChIKey is QSWFEURRYYQBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.ClH/c1-2-4-10-8(3-1)9-7-11-5-6-12-9;/h1-4,9H,5-7H2;1H.
What are the key properties of 2-(1,4-dioxan-2-yl)pyridine;hydrochloride?
2-(1,4-dioxan-2-yl)pyridine;hydrochloride has a molecular weight of 201.65 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxan-2-yl)pyridine;hydrochloride is sourced from PubChem (CID 174921928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).