C10H11F2NO2 — CID 171781241
2-[[(2R)-1,4-dioxan-2-yl]-difluoromethyl]pyridine (PubChem CID 171781241) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-[[(2R)-1,4-dioxan-2-yl]-difluoromethyl]pyridine.
| Compound Name | 2-[[(2R)-1,4-dioxan-2-yl]-difluoromethyl]pyridine |
|---|---|
| PubChem CID | 171781241 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-[[(2R)-1,4-dioxan-2-yl]-difluoromethyl]pyridine |
| SMILES | FC(F)(c1ccccn1)[C@H]1COCCO1 |
| InChI | InChI=1S/C10H11F2NO2/c11-10(12,8-3-1-2-4-13-8)9-7-14-5-6-15-9/h1-4,9H,5-7H2/t9-/m1/s1 |
| InChIKey | UREVTYHVYIQLLG-SECBINFHSA-N |
| XLogP | 1.59 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |