C11H16N2O2 — CID 60960687
1-(1,4-dioxan-2-yl)-N-(pyridin-2-ylmethyl)methanamine (PubChem CID 60960687) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-N-(pyridin-2-ylmethyl)methanamine.
| Compound Name | 1-(1,4-dioxan-2-yl)-N-(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 60960687 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-N-(pyridin-2-ylmethyl)methanamine |
| SMILES | c1ccc(CNCC2COCCO2)nc1 |
| InChI | InChI=1S/C11H16N2O2/c1-2-4-13-10(3-1)7-12-8-11-9-14-5-6-15-11/h1-4,11-12H,5-9H2 |
| InChIKey | LEVAOXRVPVYMBD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |