C12H15Cl2NO2 — CID 54893724
N-[(3,4-dichlorophenyl)methyl]-1-(1,4-dioxan-2-yl)methanamine (PubChem CID 54893724) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-1-(1,4-dioxan-2-yl)methanamine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-1-(1,4-dioxan-2-yl)methanamine |
|---|---|
| PubChem CID | 54893724 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-1-(1,4-dioxan-2-yl)methanamine |
| SMILES | Clc1ccc(CNCC2COCCO2)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO2/c13-11-2-1-9(5-12(11)14)6-15-7-10-8-16-3-4-17-10/h1-2,5,10,15H,3-4,6-8H2 |
| InChIKey | IQVIKYNLQAPBEM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |