C13H16N2O2 — CID 54893348
3-[(1,4-dioxan-2-ylmethylamino)methyl]benzonitrile (PubChem CID 54893348) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-[(1,4-dioxan-2-ylmethylamino)methyl]benzonitrile.
| Compound Name | 3-[(1,4-dioxan-2-ylmethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 54893348 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-[(1,4-dioxan-2-ylmethylamino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNCC2COCCO2)c1 |
| InChI | InChI=1S/C13H16N2O2/c14-7-11-2-1-3-12(6-11)8-15-9-13-10-16-4-5-17-13/h1-3,6,13,15H,4-5,8-10H2 |
| InChIKey | XNXAWDZSTXQEHY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |