C15H17BrN2O2 — CID 115959206
N-[(5-bromoquinolin-8-yl)methyl]-1-(1,4-dioxan-2-yl)methanamine (PubChem CID 115959206) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is N-[(5-bromoquinolin-8-yl)methyl]-1-(1,4-dioxan-2-yl)methanamine.
| Compound Name | N-[(5-bromoquinolin-8-yl)methyl]-1-(1,4-dioxan-2-yl)methanamine |
|---|---|
| PubChem CID | 115959206 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | N-[(5-bromoquinolin-8-yl)methyl]-1-(1,4-dioxan-2-yl)methanamine |
| SMILES | Brc1ccc(CNCC2COCCO2)c2ncccc12 |
| InChI | InChI=1S/C15H17BrN2O2/c16-14-4-3-11(15-13(14)2-1-5-18-15)8-17-9-12-10-19-6-7-20-12/h1-5,12,17H,6-10H2 |
| InChIKey | SANLVIPSVGJCNE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |