C9H10BrNO2 — CID 130138724
5-bromo-2-(1,4-dioxan-2-yl)pyridine (PubChem CID 130138724) has the molecular formula C9H10BrNO2 and a molecular weight of 244.09 g/mol. Its IUPAC name is 5-bromo-2-(1,4-dioxan-2-yl)pyridine.
| Compound Name | 5-bromo-2-(1,4-dioxan-2-yl)pyridine |
|---|---|
| PubChem CID | 130138724 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 5-bromo-2-(1,4-dioxan-2-yl)pyridine |
| SMILES | Brc1ccc(C2COCCO2)nc1 |
| InChI | InChI=1S/C9H10BrNO2/c10-7-1-2-8(11-5-7)9-6-12-3-4-13-9/h1-2,5,9H,3-4,6H2 |
| InChIKey | LNLSQAPFNGVFBD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |