C14H19BrO4 — CID 619658
2-(2-bromophenyl)-1,4,7,10-tetraoxacyclododecane (PubChem CID 619658) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1,4,7,10-tetraoxacyclododecane.
| Compound Name | 2-(2-bromophenyl)-1,4,7,10-tetraoxacyclododecane |
|---|---|
| PubChem CID | 619658 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-(2-bromophenyl)-1,4,7,10-tetraoxacyclododecane |
| SMILES | Brc1ccccc1C1COCCOCCOCCO1 |
| InChI | InChI=1S/C14H19BrO4/c15-13-4-2-1-3-12(13)14-11-18-8-7-16-5-6-17-9-10-19-14/h1-4,14H,5-11H2 |
| InChIKey | ZCDCPYLWWTXTRK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |