C20H31BO8 — CID 542514
2-[2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 542514) has the molecular formula C20H31BO8 and a molecular weight of 410.27 g/mol. Its IUPAC name is 2-[2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 542514 |
| Molecular Formula | C20H31BO8 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | c1ccc(C2COCCOCCOCCOCCOCCO2)c(B2OCCO2)c1 |
| InChI | InChI=1S/C20H31BO8/c1-2-4-19(21-28-15-16-29-21)18(3-1)20-17-26-12-11-24-8-7-22-5-6-23-9-10-25-13-14-27-20/h1-4,20H,5-17H2 |
| InChIKey | LTORPCJUBZBBFY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|