C8H6BrNO2 — CID 141192691
5-bromo-2-(1,3-dioxol-2-yl)pyridine (PubChem CID 141192691) has the molecular formula C8H6BrNO2 and a molecular weight of 228.05 g/mol. Its IUPAC name is 5-bromo-2-(1,3-dioxol-2-yl)pyridine.
| Compound Name | 5-bromo-2-(1,3-dioxol-2-yl)pyridine |
|---|---|
| PubChem CID | 141192691 |
| Molecular Formula | C8H6BrNO2 |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 226.96 |
| IUPAC Name | 5-bromo-2-(1,3-dioxol-2-yl)pyridine |
| SMILES | Brc1ccc(C2OC=CO2)nc1 |
| InChI | InChI=1S/C8H6BrNO2/c9-6-1-2-7(10-5-6)8-11-3-4-12-8/h1-5,8H |
| InChIKey | ULYMTPTXRRQCJD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |