C11H12BrNO3 — CID 115801104
2-(5-bromo-2-pyridinyl)-1-(1,4-dioxan-2-yl)ethanone (PubChem CID 115801104) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is 2-(5-bromo-2-pyridinyl)-1-(1,4-dioxan-2-yl)ethanone.
| Compound Name | 2-(5-bromo-2-pyridinyl)-1-(1,4-dioxan-2-yl)ethanone |
|---|---|
| PubChem CID | 115801104 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-(5-bromo-2-pyridinyl)-1-(1,4-dioxan-2-yl)ethanone |
| SMILES | O=C(Cc1ccc(Br)cn1)C1COCCO1 |
| InChI | InChI=1S/C11H12BrNO3/c12-8-1-2-9(13-6-8)5-10(14)11-7-15-3-4-16-11/h1-2,6,11H,3-5,7H2 |
| InChIKey | FRVQHHBAGOPNGW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |