About 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone
2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone (PubChem CID 131107631) has the molecular formula C10H11BrO4
and a molecular weight of 275.10 g/mol. Its IUPAC name is 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone |
| PubChem CID | 131107631 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone |
| SMILES | O=C(Cc1coc(Br)c1)C1COCCO1 |
| InChI | InChI=1S/C10H11BrO4/c11-10-4-7(5-15-10)3-8(12)9-6-13-1-2-14-9/h4-5,9H,1-3,6H2 |
| InChIKey | QLKHAVCFZPBYOR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone?
The IUPAC name of 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone (CID 131107631) is 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone.
What is the SMILES notation for 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone?
The canonical SMILES for 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone is O=C(Cc1coc(Br)c1)C1COCCO1.
What is the InChIKey of 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone?
The InChIKey is QLKHAVCFZPBYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO4/c11-10-4-7(5-15-10)3-8(12)9-6-13-1-2-14-9/h4-5,9H,1-3,6H2.
What are the key properties of 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone?
2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone has a molecular weight of 275.10 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone is sourced from PubChem (CID 131107631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).