C10H11BrO4 — CID 131107631
2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone (PubChem CID 131107631) has the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. Its IUPAC name is 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone.
| Compound Name | 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone |
|---|---|
| PubChem CID | 131107631 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-(5-bromofuran-3-yl)-1-(1,4-dioxan-2-yl)ethanone |
| SMILES | O=C(Cc1coc(Br)c1)C1COCCO1 |
| InChI | InChI=1S/C10H11BrO4/c11-10-4-7(5-15-10)3-8(12)9-6-13-1-2-14-9/h4-5,9H,1-3,6H2 |
| InChIKey | QLKHAVCFZPBYOR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |