C15H19BrO5 — CID 62799898
(2-bromo-4,5-diethoxyphenyl)-(1,4-dioxan-2-yl)methanone (PubChem CID 62799898) has the molecular formula C15H19BrO5 and a molecular weight of 359.22 g/mol. Its IUPAC name is (2-bromo-4,5-diethoxyphenyl)-(1,4-dioxan-2-yl)methanone.
| Compound Name | (2-bromo-4,5-diethoxyphenyl)-(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 62799898 |
| Molecular Formula | C15H19BrO5 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (2-bromo-4,5-diethoxyphenyl)-(1,4-dioxan-2-yl)methanone |
| SMILES | CCOc1cc(Br)c(C(=O)C2COCCO2)cc1OCC |
| InChI | InChI=1S/C15H19BrO5/c1-3-19-12-7-10(11(16)8-13(12)20-4-2)15(17)14-9-18-5-6-21-14/h7-8,14H,3-6,9H2,1-2H3 |
| InChIKey | KRYOKMFHERXSHH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |