C12H13BrO3 — CID 62803295
2-(3-bromophenyl)-1-(1,4-dioxan-2-yl)ethanone (PubChem CID 62803295) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(1,4-dioxan-2-yl)ethanone.
| Compound Name | 2-(3-bromophenyl)-1-(1,4-dioxan-2-yl)ethanone |
|---|---|
| PubChem CID | 62803295 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 2-(3-bromophenyl)-1-(1,4-dioxan-2-yl)ethanone |
| SMILES | O=C(Cc1cccc(Br)c1)C1COCCO1 |
| InChI | InChI=1S/C12H13BrO3/c13-10-3-1-2-9(6-10)7-11(14)12-8-15-4-5-16-12/h1-3,6,12H,4-5,7-8H2 |
| InChIKey | BIKHMDYMELVCFG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |