C12H13BrO2S — CID 79962669
2-(3-bromophenyl)-1-(1,4-oxathian-2-yl)ethanone (PubChem CID 79962669) has the molecular formula C12H13BrO2S and a molecular weight of 301.20 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(1,4-oxathian-2-yl)ethanone.
| Compound Name | 2-(3-bromophenyl)-1-(1,4-oxathian-2-yl)ethanone |
|---|---|
| PubChem CID | 79962669 |
| Molecular Formula | C12H13BrO2S |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 2-(3-bromophenyl)-1-(1,4-oxathian-2-yl)ethanone |
| SMILES | O=C(Cc1cccc(Br)c1)C1CSCCO1 |
| InChI | InChI=1S/C12H13BrO2S/c13-10-3-1-2-9(6-10)7-11(14)12-8-16-5-4-15-12/h1-3,6,12H,4-5,7-8H2 |
| InChIKey | CTLMHJSOQQPIFF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |