C16H21BrN2O2 — CID 6466812
[4-[(3-bromophenyl)methyl]piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 6466812) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is [4-[(3-bromophenyl)methyl]piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[(3-bromophenyl)methyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 6466812 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | [4-[(3-bromophenyl)methyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H21BrN2O2/c17-14-4-1-3-13(11-14)12-18-6-8-19(9-7-18)16(20)15-5-2-10-21-15/h1,3-4,11,15H,2,5-10,12H2 |
| InChIKey | WIXJCKAGLDIUNL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |