C17H22F2N2O2S — CID 49229106
[4-[[4-(difluoromethylsulfanyl)phenyl]methyl]piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 49229106) has the molecular formula C17H22F2N2O2S and a molecular weight of 356.44 g/mol. Its IUPAC name is [4-[[4-(difluoromethylsulfanyl)phenyl]methyl]piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[[4-(difluoromethylsulfanyl)phenyl]methyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 49229106 |
| Molecular Formula | C17H22F2N2O2S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [4-[[4-(difluoromethylsulfanyl)phenyl]methyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(Cc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H22F2N2O2S/c18-17(19)24-14-5-3-13(4-6-14)12-20-7-9-21(10-8-20)16(22)15-2-1-11-23-15/h3-6,15,17H,1-2,7-12H2 |
| InChIKey | BLLYGUKAFVDNTA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |