C17H21F2N3O2S — CID 49230244
N-cyclopropyl-2-[4-[[4-(difluoromethylsulfanyl)phenyl]methyl]piperazin-1-yl]-2-oxoacetamide (PubChem CID 49230244) has the molecular formula C17H21F2N3O2S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[[4-(difluoromethylsulfanyl)phenyl]methyl]piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[4-[[4-(difluoromethylsulfanyl)phenyl]methyl]piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 49230244 |
| Molecular Formula | C17H21F2N3O2S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-cyclopropyl-2-[4-[[4-(difluoromethylsulfanyl)phenyl]methyl]piperazin-1-yl]-2-oxoacetamide |
| SMILES | O=C(NC1CC1)C(=O)N1CCN(Cc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H21F2N3O2S/c18-17(19)25-14-5-1-12(2-6-14)11-21-7-9-22(10-8-21)16(24)15(23)20-13-3-4-13/h1-2,5-6,13,17H,3-4,7-11H2,(H,20,23) |
| InChIKey | YKXNJADQSFRANS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|