C12H13F2NO2S — CID 8701259
(2R)-N-[4-(difluoromethylsulfanyl)phenyl]oxolane-2-carboxamide (PubChem CID 8701259) has the molecular formula C12H13F2NO2S and a molecular weight of 273.30 g/mol. Its IUPAC name is (2R)-N-[4-(difluoromethylsulfanyl)phenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[4-(difluoromethylsulfanyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 8701259 |
| Molecular Formula | C12H13F2NO2S |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2R)-N-[4-(difluoromethylsulfanyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)[C@H]1CCCO1 |
| InChI | InChI=1S/C12H13F2NO2S/c13-12(14)18-9-5-3-8(4-6-9)15-11(16)10-2-1-7-17-10/h3-6,10,12H,1-2,7H2,(H,15,16)/t10-/m1/s1 |
| InChIKey | OKZUOZIBOSEKJQ-SNVBAGLBSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |