C19H21NO2S — CID 24658670
N-[4-(3,4-dimethylphenyl)sulfanylphenyl]oxolane-2-carboxamide (PubChem CID 24658670) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)sulfanylphenyl]oxolane-2-carboxamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)sulfanylphenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 24658670 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)sulfanylphenyl]oxolane-2-carboxamide |
| SMILES | Cc1ccc(Sc2ccc(NC(=O)C3CCCO3)cc2)cc1C |
| InChI | InChI=1S/C19H21NO2S/c1-13-5-8-17(12-14(13)2)23-16-9-6-15(7-10-16)20-19(21)18-4-3-11-22-18/h5-10,12,18H,3-4,11H2,1-2H3,(H,20,21) |
| InChIKey | ABDAFDQCWIXFSU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |