C18H16F2N2O2S — CID 26908479
4-(cyclopropanecarbonylamino)-N-[4-(difluoromethylsulfanyl)phenyl]benzamide (PubChem CID 26908479) has the molecular formula C18H16F2N2O2S and a molecular weight of 362.40 g/mol. Its IUPAC name is 4-(cyclopropanecarbonylamino)-N-[4-(difluoromethylsulfanyl)phenyl]benzamide.
| Compound Name | 4-(cyclopropanecarbonylamino)-N-[4-(difluoromethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26908479 |
| Molecular Formula | C18H16F2N2O2S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-(cyclopropanecarbonylamino)-N-[4-(difluoromethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C18H16F2N2O2S/c19-18(20)25-15-9-7-14(8-10-15)22-17(24)12-3-5-13(6-4-12)21-16(23)11-1-2-11/h3-11,18H,1-2H2,(H,21,23)(H,22,24) |
| InChIKey | JGLKGTUTRYHNOL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |