C15H20F2N2OS — CID 79511673
4-(aminomethyl)-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 79511673) has the molecular formula C15H20F2N2OS and a molecular weight of 314.40 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79511673 |
| Molecular Formula | C15H20F2N2OS |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-(aminomethyl)-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | NCC1CCC(C(=O)Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H20F2N2OS/c16-15(17)21-13-7-5-12(6-8-13)19-14(20)11-3-1-10(9-18)2-4-11/h5-8,10-11,15H,1-4,9,18H2,(H,19,20) |
| InChIKey | YSPSMWMMRCZAJS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |