C14H19ClF2N2OS — CID 119668988
3-amino-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119668988) has the molecular formula C14H19ClF2N2OS and a molecular weight of 336.84 g/mol. Its IUPAC name is 3-amino-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119668988 |
| Molecular Formula | C14H19ClF2N2OS |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-amino-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)Nc2ccc(SC(F)F)cc2)C1 |
| InChI | InChI=1S/C14H18F2N2OS.ClH/c15-14(16)20-12-6-4-11(5-7-12)18-13(19)9-2-1-3-10(17)8-9;/h4-7,9-10,14H,1-3,8,17H2,(H,18,19);1H |
| InChIKey | SIHMVYCUZDWCCV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |