C13H16F2N2OS — CID 64824498
2-amino-N-[4-(difluoromethylsulfanyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 64824498) has the molecular formula C13H16F2N2OS and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-amino-N-[4-(difluoromethylsulfanyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 2-amino-N-[4-(difluoromethylsulfanyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 64824498 |
| Molecular Formula | C13H16F2N2OS |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-amino-N-[4-(difluoromethylsulfanyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | NC1CCCC1C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C13H16F2N2OS/c14-13(15)19-9-6-4-8(5-7-9)17-12(18)10-2-1-3-11(10)16/h4-7,10-11,13H,1-3,16H2,(H,17,18) |
| InChIKey | IQASXNGGOAWHAF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |