C20H16F4N2O2S2 — CID 42917162
(2R)-1-N,2-N-bis[4-(difluoromethylsulfanyl)phenyl]-3-methylidenecyclopropane-1,2-dicarboxamide (PubChem CID 42917162) has the molecular formula C20H16F4N2O2S2 and a molecular weight of 456.49 g/mol. Its IUPAC name is (2R)-1-N,2-N-bis[4-(difluoromethylsulfanyl)phenyl]-3-methylidenecyclopropane-1,2-dicarboxamide.
| Compound Name | (2R)-1-N,2-N-bis[4-(difluoromethylsulfanyl)phenyl]-3-methylidenecyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 42917162 |
| Molecular Formula | C20H16F4N2O2S2 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (2R)-1-N,2-N-bis[4-(difluoromethylsulfanyl)phenyl]-3-methylidenecyclopropane-1,2-dicarboxamide |
| SMILES | C=C1C(C(=O)Nc2ccc(SC(F)F)cc2)[C@H]1C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C20H16F4N2O2S2/c1-10-15(17(27)25-11-2-6-13(7-3-11)29-19(21)22)16(10)18(28)26-12-4-8-14(9-5-12)30-20(23)24/h2-9,15-16,19-20H,1H2,(H,25,27)(H,26,28)/t15-,16?/m0/s1 |
| InChIKey | WVAKZIVLOWFRRI-VYRBHSGPSA-N |
| XLogP | 5.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|