C18H14F2N2O2 — CID 21177965
(2S)-1-N,2-N-bis(4-fluorophenyl)-3-methylidenecyclopropane-1,2-dicarboxamide (PubChem CID 21177965) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is (2S)-1-N,2-N-bis(4-fluorophenyl)-3-methylidenecyclopropane-1,2-dicarboxamide.
| Compound Name | (2S)-1-N,2-N-bis(4-fluorophenyl)-3-methylidenecyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 21177965 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (2S)-1-N,2-N-bis(4-fluorophenyl)-3-methylidenecyclopropane-1,2-dicarboxamide |
| SMILES | C=C1C(C(=O)Nc2ccc(F)cc2)[C@@H]1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H14F2N2O2/c1-10-15(17(23)21-13-6-2-11(19)3-7-13)16(10)18(24)22-14-8-4-12(20)5-9-14/h2-9,15-16H,1H2,(H,21,23)(H,22,24)/t15-,16?/m1/s1 |
| InChIKey | KGZKFWUCNXIMMX-AAFJCEBUSA-N |
| XLogP | 3.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|