C30H24N2O2 — CID 21177977
(2S)-3-methylidene-1-N,2-N-bis(4-phenylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 21177977) has the molecular formula C30H24N2O2 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2S)-3-methylidene-1-N,2-N-bis(4-phenylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | (2S)-3-methylidene-1-N,2-N-bis(4-phenylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 21177977 |
| Molecular Formula | C30H24N2O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (2S)-3-methylidene-1-N,2-N-bis(4-phenylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | C=C1C(C(=O)Nc2ccc(-c3ccccc3)cc2)[C@@H]1C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2O2/c1-20-27(29(33)31-25-16-12-23(13-17-25)21-8-4-2-5-9-21)28(20)30(34)32-26-18-14-24(15-19-26)22-10-6-3-7-11-22/h2-19,27-28H,1H2,(H,31,33)(H,32,34)/t27-,28?/m1/s1 |
| InChIKey | CRZLCZVPGSGGGD-QXPUDEPPSA-N |
| XLogP | 6.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|