C22H24N2O4 — CID 21177970
(2S)-1-N,2-N-bis(4-ethoxyphenyl)-3-methylidenecyclopropane-1,2-dicarboxamide (PubChem CID 21177970) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2S)-1-N,2-N-bis(4-ethoxyphenyl)-3-methylidenecyclopropane-1,2-dicarboxamide.
| Compound Name | (2S)-1-N,2-N-bis(4-ethoxyphenyl)-3-methylidenecyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 21177970 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2S)-1-N,2-N-bis(4-ethoxyphenyl)-3-methylidenecyclopropane-1,2-dicarboxamide |
| SMILES | C=C1C(C(=O)Nc2ccc(OCC)cc2)[C@@H]1C(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-4-27-17-10-6-15(7-11-17)23-21(25)19-14(3)20(19)22(26)24-16-8-12-18(13-9-16)28-5-2/h6-13,19-20H,3-5H2,1-2H3,(H,23,25)(H,24,26)/t19-,20?/m1/s1 |
| InChIKey | BHNLUNHGDVNJGF-FIWHBWSRSA-N |
| XLogP | 3.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|