C20H29NO2 — CID 122582378
N-(4-ethoxyphenyl)-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide (PubChem CID 122582378) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 122582378 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-(4-ethoxyphenyl)-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
| SMILES | C=C(C)C1CCC(C)(C)CC1C(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C20H29NO2/c1-6-23-16-9-7-15(8-10-16)21-19(22)18-13-20(4,5)12-11-17(18)14(2)3/h7-10,17-18H,2,6,11-13H2,1,3-5H3,(H,21,22) |
| InChIKey | SWVCCPUFCQVLQI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|