C20H26N2O — CID 122582379
trans-(1S,2S)-N-[4-(cyanomethyl)phenyl]-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide (PubChem CID 122582379) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is trans-(1S,2S)-N-[4-(cyanomethyl)phenyl]-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[4-(cyanomethyl)phenyl]-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 122582379 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | trans-(1S,2S)-N-[4-(cyanomethyl)phenyl]-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
| SMILES | C=C(C)[C@H]1CCC(C)(C)C[C@@H]1C(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C20H26N2O/c1-14(2)17-9-11-20(3,4)13-18(17)19(23)22-16-7-5-15(6-8-16)10-12-21/h5-8,17-18H,1,9-11,13H2,2-4H3,(H,22,23)/t17-,18+/m1/s1 |
| InChIKey | QULSQLJZJFGOEN-MSOLQXFVSA-N |
| XLogP | 4.71 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|