C22H18FNO — CID 7432800
(1R)-N-(4-fluorophenyl)-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 7432800) has the molecular formula C22H18FNO and a molecular weight of 331.39 g/mol. Its IUPAC name is (1R)-N-(4-fluorophenyl)-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-(4-fluorophenyl)-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7432800 |
| Molecular Formula | C22H18FNO |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (1R)-N-(4-fluorophenyl)-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18FNO/c23-18-11-13-19(14-12-18)24-21(25)20-15-22(20,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,20H,15H2,(H,24,25)/t20-/m0/s1 |
| InChIKey | PJGKZSZFRDCQRL-FQEVSTJZSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |