C23H21NO — CID 1247410
(1R)-N-benzyl-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 1247410) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is (1R)-N-benzyl-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-benzyl-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 1247410 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (1R)-N-benzyl-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO/c25-22(24-17-18-10-4-1-5-11-18)21-16-23(21,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17H2,(H,24,25)/t21-/m0/s1 |
| InChIKey | WKGOSRJDSAYJSH-NRFANRHFSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |