C22H20N2O — CID 683234
(1R)-2,2-diphenyl-N-(pyridin-3-ylmethyl)cyclopropane-1-carboxamide (PubChem CID 683234) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (1R)-2,2-diphenyl-N-(pyridin-3-ylmethyl)cyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-diphenyl-N-(pyridin-3-ylmethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 683234 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1R)-2,2-diphenyl-N-(pyridin-3-ylmethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O/c25-21(24-16-17-8-7-13-23-15-17)20-14-22(20,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-13,15,20H,14,16H2,(H,24,25)/t20-/m0/s1 |
| InChIKey | ZVNYTGLKJNQSKV-FQEVSTJZSA-N |
| XLogP | 3.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |