C21H25N3O2 — CID 3548176
1-butyl-3-[(2,2-diphenylcyclopropanecarbonyl)amino]urea (PubChem CID 3548176) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-butyl-3-[(2,2-diphenylcyclopropanecarbonyl)amino]urea.
| Compound Name | 1-butyl-3-[(2,2-diphenylcyclopropanecarbonyl)amino]urea |
|---|---|
| PubChem CID | 3548176 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-butyl-3-[(2,2-diphenylcyclopropanecarbonyl)amino]urea |
| SMILES | CCCCNC(=O)NNC(=O)C1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-2-3-14-22-20(26)24-23-19(25)18-15-21(18,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18H,2-3,14-15H2,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | YXXPDMHJVOJDSK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|