C28H23N3O — CID 6611307
2,2-diphenyl-N-(4-phenyldiazenylphenyl)cyclopropane-1-carboxamide (PubChem CID 6611307) has the molecular formula C28H23N3O and a molecular weight of 417.51 g/mol. Its IUPAC name is 2,2-diphenyl-N-(4-phenyldiazenylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-diphenyl-N-(4-phenyldiazenylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6611307 |
| Molecular Formula | C28H23N3O |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2,2-diphenyl-N-(4-phenyldiazenylphenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1)C1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23N3O/c32-27(29-23-16-18-25(19-17-23)31-30-24-14-8-3-9-15-24)26-20-28(26,21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-19,26H,20H2,(H,29,32)/b31-30+ |
| InChIKey | OOOVGVTVOBELIC-NVQSTNCTSA-N |
| XLogP | 7.05 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|