C14H11Cl2N3O — CID 5180654
2,2-dichloro-N-(4-phenyldiazenylphenyl)acetamide (PubChem CID 5180654) has the molecular formula C14H11Cl2N3O and a molecular weight of 308.17 g/mol. Its IUPAC name is 2,2-dichloro-N-(4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2,2-dichloro-N-(4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 5180654 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2,2-dichloro-N-(4-phenyldiazenylphenyl)acetamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C14H11Cl2N3O/c15-13(16)14(20)17-10-6-8-12(9-7-10)19-18-11-4-2-1-3-5-11/h1-9,13H,(H,17,20)/b19-18+ |
| InChIKey | QXEZXKFWSPGKRZ-VHEBQXMUSA-N |
| XLogP | 4.84 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|