C19H13Cl2N3O — CID 3386476
2,6-dichloro-N-(4-phenyldiazenylphenyl)benzamide (PubChem CID 3386476) has the molecular formula C19H13Cl2N3O and a molecular weight of 370.24 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-phenyldiazenylphenyl)benzamide.
| Compound Name | 2,6-dichloro-N-(4-phenyldiazenylphenyl)benzamide |
|---|---|
| PubChem CID | 3386476 |
| Molecular Formula | C19H13Cl2N3O |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2,6-dichloro-N-(4-phenyldiazenylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H13Cl2N3O/c20-16-7-4-8-17(21)18(16)19(25)22-13-9-11-15(12-10-13)24-23-14-5-2-1-3-6-14/h1-12H,(H,22,25)/b24-23+ |
| InChIKey | IDIXVNJMDHVDDE-WCWDXBQESA-N |
| XLogP | 6.66 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|