C13H8Cl3NO — CID 68933625
2,4,6-trichloro-N-phenylbenzamide (PubChem CID 68933625) has the molecular formula C13H8Cl3NO and a molecular weight of 300.57 g/mol. Its IUPAC name is 2,4,6-trichloro-N-phenylbenzamide.
| Compound Name | 2,4,6-trichloro-N-phenylbenzamide |
|---|---|
| PubChem CID | 68933625 |
| Molecular Formula | C13H8Cl3NO |
| Molecular Weight | 300.57 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 2,4,6-trichloro-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl3NO/c14-8-6-10(15)12(11(16)7-8)13(18)17-9-4-2-1-3-5-9/h1-7H,(H,17,18) |
| InChIKey | UBOHMMUSDIXLPV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |