C17H10Cl3N3O2S — CID 11690446
N-phenyl-5-[(2,4,6-trichlorobenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 11690446) has the molecular formula C17H10Cl3N3O2S and a molecular weight of 426.71 g/mol. Its IUPAC name is N-phenyl-5-[(2,4,6-trichlorobenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-phenyl-5-[(2,4,6-trichlorobenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 11690446 |
| Molecular Formula | C17H10Cl3N3O2S |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | N-phenyl-5-[(2,4,6-trichlorobenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ncsc1NC(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl3N3O2S/c18-9-6-11(19)13(12(20)7-9)15(24)23-17-14(21-8-26-17)16(25)22-10-4-2-1-3-5-10/h1-8H,(H,22,25)(H,23,24) |
| InChIKey | OUYKHNHVHUGDCD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |