5-benzamido-1,3-thiazole-4-carboxylic acid

C11H8N2O3S — CID 69246207

IUPAC5-benzamido-1,3-thiazole-4-carboxylic acid
SMILESO=C(Nc1scnc1C(=O)O)c1ccccc1
InChIInChI=1S/C11H8N2O3S/c14-9(7-4-2-1-3-5-7)13-10-8(11(15)16)12-6-17-10/h1-6H,(H,13,14)(H,15,16)
InChIKeyHZKPSAXNSKBEBE-UHFFFAOYSA-N
MW248.26 g/mol
LogP2.09
Rot. Bonds3

About 5-benzamido-1,3-thiazole-4-carboxylic acid

5-benzamido-1,3-thiazole-4-carboxylic acid (PubChem CID 69246207) has the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. Its IUPAC name is 5-benzamido-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-benzamido-1,3-thiazole-4-carboxylic acid
PubChem CID69246207
Molecular FormulaC11H8N2O3S
Molecular Weight248.26 g/mol
Exact Mass248.03
IUPAC Name5-benzamido-1,3-thiazole-4-carboxylic acid
SMILESO=C(Nc1scnc1C(=O)O)c1ccccc1
InChIInChI=1S/C11H8N2O3S/c14-9(7-4-2-1-3-5-7)13-10-8(11(15)16)12-6-17-10/h1-6H,(H,13,14)(H,15,16)
InChIKeyHZKPSAXNSKBEBE-UHFFFAOYSA-N
XLogP2.09
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.26
LogP ≤ 52.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-benzamido-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-benzamido-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-benzamido-1,3-thiazole-4-carboxylic acid (CID 69246207) is 5-benzamido-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-benzamido-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-benzamido-1,3-thiazole-4-carboxylic acid is O=C(Nc1scnc1C(=O)O)c1ccccc1.
What is the InChIKey of 5-benzamido-1,3-thiazole-4-carboxylic acid?
The InChIKey is HZKPSAXNSKBEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O3S/c14-9(7-4-2-1-3-5-7)13-10-8(11(15)16)12-6-17-10/h1-6H,(H,13,14)(H,15,16).
What are the key properties of 5-benzamido-1,3-thiazole-4-carboxylic acid?
5-benzamido-1,3-thiazole-4-carboxylic acid has a molecular weight of 248.26 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzamido-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 69246207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).