C16H18ClN3OS — CID 90909832
N-(3-chlorophenyl)-5-(cyclohexylamino)-1,3-thiazole-4-carboxamide (PubChem CID 90909832) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(cyclohexylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-(cyclohexylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90909832 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-(3-chlorophenyl)-5-(cyclohexylamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ncsc1NC1CCCCC1 |
| InChI | InChI=1S/C16H18ClN3OS/c17-11-5-4-8-13(9-11)19-15(21)14-16(22-10-18-14)20-12-6-2-1-3-7-12/h4-5,8-10,12,20H,1-3,6-7H2,(H,19,21) |
| InChIKey | VVGQLUGRQFCUIB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |