C10H8Cl4N2O2 — CID 840731
2,2-dichloro-N-[3-[(2,2-dichloroacetyl)amino]phenyl]acetamide (PubChem CID 840731) has the molecular formula C10H8Cl4N2O2 and a molecular weight of 330.00 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[(2,2-dichloroacetyl)amino]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-[(2,2-dichloroacetyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 840731 |
| Molecular Formula | C10H8Cl4N2O2 |
| Molecular Weight | 330.00 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 2,2-dichloro-N-[3-[(2,2-dichloroacetyl)amino]phenyl]acetamide |
| SMILES | O=C(Nc1cccc(NC(=O)C(Cl)Cl)c1)C(Cl)Cl |
| InChI | InChI=1S/C10H8Cl4N2O2/c11-7(12)9(17)15-5-2-1-3-6(4-5)16-10(18)8(13)14/h1-4,7-8H,(H,15,17)(H,16,18) |
| InChIKey | BVPVLZIQAGQGFP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.00 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|