C22H25Cl2NO2 — CID 2803590
2,2-dichloro-N-[3-[3-oxo-3-(2,3,4,5,6-pentamethylphenyl)propyl]phenyl]acetamide (PubChem CID 2803590) has the molecular formula C22H25Cl2NO2 and a molecular weight of 406.35 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[3-oxo-3-(2,3,4,5,6-pentamethylphenyl)propyl]phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-[3-oxo-3-(2,3,4,5,6-pentamethylphenyl)propyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2803590 |
| Molecular Formula | C22H25Cl2NO2 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2,2-dichloro-N-[3-[3-oxo-3-(2,3,4,5,6-pentamethylphenyl)propyl]phenyl]acetamide |
| SMILES | Cc1c(C)c(C)c(C(=O)CCc2cccc(NC(=O)C(Cl)Cl)c2)c(C)c1C |
| InChI | InChI=1S/C22H25Cl2NO2/c1-12-13(2)15(4)20(16(5)14(12)3)19(26)10-9-17-7-6-8-18(11-17)25-22(27)21(23)24/h6-8,11,21H,9-10H2,1-5H3,(H,25,27) |
| InChIKey | BSKUEKIGUPUAFB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|