C36H47N3O3 — CID 67992270
1-N,2-N,3-N-tris(3-butylphenyl)propane-1,2,3-tricarboxamide (PubChem CID 67992270) has the molecular formula C36H47N3O3 and a molecular weight of 569.79 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris(3-butylphenyl)propane-1,2,3-tricarboxamide.
| Compound Name | 1-N,2-N,3-N-tris(3-butylphenyl)propane-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 67992270 |
| Molecular Formula | C36H47N3O3 |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.36 |
| IUPAC Name | 1-N,2-N,3-N-tris(3-butylphenyl)propane-1,2,3-tricarboxamide |
| SMILES | CCCCc1cccc(NC(=O)CC(CC(=O)Nc2cccc(CCCC)c2)C(=O)Nc2cccc(CCCC)c2)c1 |
| InChI | InChI=1S/C36H47N3O3/c1-4-7-13-27-16-10-19-31(22-27)37-34(40)25-30(36(42)39-33-21-12-18-29(24-33)15-9-6-3)26-35(41)38-32-20-11-17-28(23-32)14-8-5-2/h10-12,16-24,30H,4-9,13-15,25-26H2,1-3H3,(H,37,40)(H,38,41)(H,39,42) |
| InChIKey | AYTPCHOGQUDICU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |